- CAS 34562-01-1
- Purity 99%
(2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid
China cas 34562-01-1 manufacturer wholesale (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid at affordable price We provide high quality (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid (CAS 34562-01-1), at a very affordable prices to our customers.
1.What is the (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid ?
(2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid is a bicyclic carboxylic acid with a molecular formula of C10H14O2. It is a synthetic compound that features a unique fused bicyclic ring system and a carboxylic acid functional group. This versatile chemical structure makes it a valuable building block in the pharmaceutical industry for the synthesis of various medicinal compounds.
Used in Pharmaceutical Industry:
(2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid is used as a building block for the synthesis of various medicinal compounds. Its unique structure allows it to be a precursor in the development of drugs targeting specific diseases and medical conditions, contributing to the advancement of pharmaceutical research and drug discovery.
Potential Applications in Other Industries:
Due to its versatile chemical structure, (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid may also have potential applications in other industries. While the specific uses are not detailed in the provided materials, its unique properties could make it suitable for various applications, such as in the development of new materials, chemical intermediates, or other specialized uses where its specific structural features are advantageous.
2.What is the CAS number for (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid ?
The CAS number of (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid is 34562-01-1.
More information of (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid 34562-01-1 are:
|
CAS?Number |
34562-01-1 |
|
Density |
1.188g/cm3 |
|
Boiling Point |
297.1°Cat760mmHg |
|
Flash Point |
139°C |
|
Vapor Pressure |
0.000331mmHg at 25°C |
|
Refractive Index |
1.55 |
3.What is the molecular formula of (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid ?
The chemical formula of?(2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid is C11 H16 O2 which containing 11 Carbon atoms,16 Hydrogen atoms and 2 Oxygen atoms,and the molecular weight, and the molecular weight of (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid is 180.247
4.What is (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid(34562-01-1)used for?
(2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid is a bicyclic carboxylic acid with a molecular formula of C10H14O2. It is a synthetic compound that features a unique fused bicyclic ring system and a carboxylic acid functional group. This versatile chemical structure makes it a valuable building block in the pharmaceutical industry for the synthesis of various medicinal compounds.
InChI:InChI=1/C11H16O2/c12-11(13)8-4-9-6-1-2-7(3-6)10(9)5-8/h6-10H,1-5H2,(H,12,13)/t6-,7+,8+,9-,10-/m1/s1
Relevant articles related to (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid:
5.China cas 34562-01-1 manufacturer wholesale (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid at affordable price
Chengdu Henghui Pharmaceutical Co., Ltd. is a quality supplier of (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on (2alpha,3aalpha,4alpha,7alpha,7abeta)-octahydro-4,7-methano-1H-indene-2-carboxylic acid 34562-01-1.